About CID 154600703
CID 154600703 (PubChem CID 154600703) has the molecular formula C49H27F3IrNO
and a molecular weight of 894.97 g/mol.
Molecular Properties
| Compound Name | CID 154600703 |
| PubChem CID | 154600703 |
| Molecular Formula | C49H27F3IrNO |
| Molecular Weight | 894.97 g/mol |
| Exact Mass | 895.17 |
| IUPAC Name | — |
| SMILES | FC(F)(F)Cc1c[c-]c(-c2nccc3ccccc23)cc1.[Ir+3].[c-]1cc2oc3c4cccc5ccc6cccc(c3c2cc1-c1[c-]ccc2ccccc12)c6c54 |
| InChI | InChI=1S/C32H16O.C17H11F3N.Ir/c1-2-10-23-19(6-1)7-3-11-24(23)22-16-17-28-27(18-22)31-25-12-4-8-20-14-15-21-9-5-13-26(32(31)33-28)30(21)29(20)25;18-17(19,20)11-12-5-7-14(8-6-12)16-15-4-2-1-3-13(15)9-10-21-16;/h1-10,12-15,17-18H;1-7,9-10H,11H2;/q-2;-1;+3 |
| InChIKey | MUKZFMNENLTAPU-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 894.97 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 154600703 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154600703?
The IUPAC name of CID 154600703 (CID 154600703) is not available.
What is the SMILES notation for CID 154600703?
The canonical SMILES for CID 154600703 is FC(F)(F)Cc1c[c-]c(-c2nccc3ccccc23)cc1.[Ir+3].[c-]1cc2oc3c4cccc5ccc6cccc(c3c2cc1-c1[c-]ccc2ccccc12)c6c54.
What is the InChIKey of CID 154600703?
The InChIKey is MUKZFMNENLTAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H16O.C17H11F3N.Ir/c1-2-10-23-19(6-1)7-3-11-24(23)22-16-17-28-27(18-22)31-25-12-4-8-20-14-15-21-9-5-13-26(32(31)33-28)30(21)29(20)25;18-17(19,20)11-12-5-7-14(8-6-12)16-15-4-2-1-3-13(15)9-10-21-16;/h1-10,12-15,17-18H;1-7,9-10H,11H2;/q-2;-1;+3.
What are the key properties of CID 154600703?
CID 154600703 has a molecular weight of 894.97 g/mol, XLogP of 13.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154600703 is sourced from PubChem (CID 154600703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).