C12H9F17O2 — CID 154600994
1,1,2,2-tetrafluoro-1-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-4-methylpentane (PubChem CID 154600994) has the molecular formula C12H9F17O2 and a molecular weight of 508.17 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-4-methylpentane.
| Compound Name | 1,1,2,2-tetrafluoro-1-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-4-methylpentane |
|---|---|
| PubChem CID | 154600994 |
| Molecular Formula | C12H9F17O2 |
| Molecular Weight | 508.17 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-4-methylpentane |
| SMILES | CC(C)CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F17O2/c1-4(2)3-5(13,14)9(22,23)30-11(26,27)7(17,18)12(28,29)31-10(24,25)6(15,16)8(19,20)21/h4H,3H2,1-2H3 |
| InChIKey | FEMIGPMYUCJVFC-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.17 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|