C11H20F4N2O — CID 154601254
2-tert-butyl-5-(2,2,3,3-tetrafluoropropoxy)piperazine (PubChem CID 154601254) has the molecular formula C11H20F4N2O and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,2,3,3-tetrafluoropropoxy)piperazine.
| Compound Name | 2-tert-butyl-5-(2,2,3,3-tetrafluoropropoxy)piperazine |
|---|---|
| PubChem CID | 154601254 |
| Molecular Formula | C11H20F4N2O |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-tert-butyl-5-(2,2,3,3-tetrafluoropropoxy)piperazine |
| SMILES | CC(C)(C)C1CNC(OCC(F)(F)C(F)F)CN1 |
| InChI | InChI=1S/C11H20F4N2O/c1-10(2,3)7-4-17-8(5-16-7)18-6-11(14,15)9(12)13/h7-9,16-17H,4-6H2,1-3H3 |
| InChIKey | KTODWUOPYUREKD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|