C24H34O7 — CID 154601448
1-O-(2-hydroxypropyl) 4-O-(10-oxo-10-phenylmethoxydecan-5-yl) (Z)-but-2-enedioate (PubChem CID 154601448) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is 1-O-(2-hydroxypropyl) 4-O-(10-oxo-10-phenylmethoxydecan-5-yl) (Z)-but-2-enedioate.
| Compound Name | 1-O-(2-hydroxypropyl) 4-O-(10-oxo-10-phenylmethoxydecan-5-yl) (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 154601448 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1-O-(2-hydroxypropyl) 4-O-(10-oxo-10-phenylmethoxydecan-5-yl) (Z)-but-2-enedioate |
| SMILES | CCCCC(CCCCC(=O)OCc1ccccc1)OC(=O)/C=C\C(=O)OCC(C)O |
| InChI | InChI=1S/C24H34O7/c1-3-4-12-21(31-24(28)16-15-23(27)29-17-19(2)25)13-8-9-14-22(26)30-18-20-10-6-5-7-11-20/h5-7,10-11,15-16,19,21,25H,3-4,8-9,12-14,17-18H2,1-2H3/b16-15- |
| InChIKey | OBEHDFIJMOUEFQ-NXVVXOECSA-N |
| XLogP | 3.87 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|