C26H32O4 — CID 154601559
3-[2,2-dimethyl-5-[4-(2-phenyl-1-benzofuran-6-yl)butyl]-1,3-dioxolan-4-yl]propan-1-ol (PubChem CID 154601559) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is 3-[2,2-dimethyl-5-[4-(2-phenyl-1-benzofuran-6-yl)butyl]-1,3-dioxolan-4-yl]propan-1-ol.
| Compound Name | 3-[2,2-dimethyl-5-[4-(2-phenyl-1-benzofuran-6-yl)butyl]-1,3-dioxolan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 154601559 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 3-[2,2-dimethyl-5-[4-(2-phenyl-1-benzofuran-6-yl)butyl]-1,3-dioxolan-4-yl]propan-1-ol |
| SMILES | CC1(C)OC(CCCO)C(CCCCc2ccc3cc(-c4ccccc4)oc3c2)O1 |
| InChI | InChI=1S/C26H32O4/c1-26(2)29-22(23(30-26)13-8-16-27)12-7-6-9-19-14-15-21-18-25(28-24(21)17-19)20-10-4-3-5-11-20/h3-5,10-11,14-15,17-18,22-23,27H,6-9,12-13,16H2,1-2H3 |
| InChIKey | VNEHFAMAURMIPK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|