C28H36O6 — CID 154601562
[4,5-dihydroxy-8-[(2-phenyl-1-benzofuran-6-yl)oxy]octyl] 2,2-dimethylbutanoate (PubChem CID 154601562) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is [4,5-dihydroxy-8-[(2-phenyl-1-benzofuran-6-yl)oxy]octyl] 2,2-dimethylbutanoate.
| Compound Name | [4,5-dihydroxy-8-[(2-phenyl-1-benzofuran-6-yl)oxy]octyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 154601562 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [4,5-dihydroxy-8-[(2-phenyl-1-benzofuran-6-yl)oxy]octyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCC(O)C(O)CCCOc1ccc2cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C28H36O6/c1-4-28(2,3)27(31)33-17-9-13-24(30)23(29)12-8-16-32-22-15-14-21-18-25(34-26(21)19-22)20-10-6-5-7-11-20/h5-7,10-11,14-15,18-19,23-24,29-30H,4,8-9,12-13,16-17H2,1-3H3 |
| InChIKey | YCCZHNWNEMQCDM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|