C17H28O3 — CID 154601709
[(6R,7S,8S,11S)-6-methyl-11-prop-1-en-2-yl-1,4-dioxadispiro[4.1.57.25]tetradecan-8-yl]methanol (PubChem CID 154601709) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(6R,7S,8S,11S)-6-methyl-11-prop-1-en-2-yl-1,4-dioxadispiro[4.1.57.25]tetradecan-8-yl]methanol.
| Compound Name | [(6R,7S,8S,11S)-6-methyl-11-prop-1-en-2-yl-1,4-dioxadispiro[4.1.57.25]tetradecan-8-yl]methanol |
|---|---|
| PubChem CID | 154601709 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(6R,7S,8S,11S)-6-methyl-11-prop-1-en-2-yl-1,4-dioxadispiro[4.1.57.25]tetradecan-8-yl]methanol |
| SMILES | C=C(C)[C@H]1CC[C@H](CO)[C@]2(CCC3(OCCO3)[C@@H]2C)C1 |
| InChI | InChI=1S/C17H28O3/c1-12(2)14-4-5-15(11-18)16(10-14)6-7-17(13(16)3)19-8-9-20-17/h13-15,18H,1,4-11H2,2-3H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | LAFQIWVGUNMITA-QKPAOTATSA-N |
| XLogP | 3.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|