C47H78F6N4O6 — CID 154602776
2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-(1-carboxynonyl)-7-(1-formyloxynonyl)-1,4,7,10-tetrazacyclododec-1-yl]decanoic acid (PubChem CID 154602776) has the molecular formula C47H78F6N4O6 and a molecular weight of 909.15 g/mol. Its IUPAC name is 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-(1-carboxynonyl)-7-(1-formyloxynonyl)-1,4,7,10-tetrazacyclododec-1-yl]decanoic acid.
| Compound Name | 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-(1-carboxynonyl)-7-(1-formyloxynonyl)-1,4,7,10-tetrazacyclododec-1-yl]decanoic acid |
|---|---|
| PubChem CID | 154602776 |
| Molecular Formula | C47H78F6N4O6 |
| Molecular Weight | 909.15 g/mol |
| Exact Mass | 908.58 |
| IUPAC Name | 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-10-(1-carboxynonyl)-7-(1-formyloxynonyl)-1,4,7,10-tetrazacyclododec-1-yl]decanoic acid |
| SMILES | CCCCCCCCC(OC=O)N1CCN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCN(C(CCCCCCCC)C(=O)O)CCN(C(CCCCCCCC)C(=O)O)CC1 |
| InChI | InChI=1S/C47H78F6N4O6/c1-4-7-10-13-16-19-22-41(44(59)60)55-27-25-54(36-38-33-39(46(48,49)50)35-40(34-38)47(51,52)53)26-28-57(43(63-37-58)24-21-18-15-12-9-6-3)32-31-56(30-29-55)42(45(61)62)23-20-17-14-11-8-5-2/h33-35,37,41-43H,4-32,36H2,1-3H3,(H,59,60)(H,61,62) |
| InChIKey | LKHXMXPGOIIWLS-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.15 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|