C32H29N3O3 — CID 154603363
2-[2-(1H-benzimidazol-2-yl)-5-methylphenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid (PubChem CID 154603363) has the molecular formula C32H29N3O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)-5-methylphenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid.
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)-5-methylphenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 154603363 |
| Molecular Formula | C32H29N3O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)-5-methylphenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid |
| SMILES | CCC[C@@H](NC(=O)c1ccc(-c2cc(C)ccc2-c2nc3ccccc3[nH]2)c(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C32H29N3O3/c1-3-9-27(21-10-5-4-6-11-21)35-31(36)22-15-17-23(26(19-22)32(37)38)25-18-20(2)14-16-24(25)30-33-28-12-7-8-13-29(28)34-30/h4-8,10-19,27H,3,9H2,1-2H3,(H,33,34)(H,35,36)(H,37,38)/t27-/m1/s1 |
| InChIKey | VKFPTSUCHKRPEL-HHHXNRCGSA-N |
| XLogP | 7.17 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |