C51H34BN3S2 — CID 154603457
5,17-Di(carbazol-9-yl)-22-(2,4,6-trimethylphenyl)-8,14-dithia-1-aza-22-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene (PubChem CID 154603457) has the molecular formula C51H34BN3S2 and a molecular weight of 763.80 g/mol. Its IUPAC name is 5,17-di(carbazol-9-yl)-22-(2,4,6-trimethylphenyl)-8,14-dithia-1-aza-22-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene.
| Compound Name | 5,17-Di(carbazol-9-yl)-22-(2,4,6-trimethylphenyl)-8,14-dithia-1-aza-22-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 154603457 |
| Molecular Formula | C51H34BN3S2 |
| Molecular Weight | 763.80 g/mol |
| Exact Mass | 763.23 |
| IUPAC Name | 5,17-di(carbazol-9-yl)-22-(2,4,6-trimethylphenyl)-8,14-dithia-1-aza-22-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
| SMILES | B1(C2=CC(=CC3=C2N4C5=C(C=C(C=C51)N6C7=CC=CC=C7C8=CC=CC=C86)SC9=CC=CC(=C94)S3)N1C2=CC=CC=C2C2=CC=CC=C21)C1=C(C=C(C=C1C)C)C |
| InChI | InChI=1S/C51H34BN3S2/c1-29-23-30(2)48(31(3)24-29)52-38-25-32(53-40-17-8-4-13-34(40)35-14-5-9-18-41(35)53)27-46-49(38)55-50-39(52)26-33(28-47(50)57-45-22-12-21-44(56-46)51(45)55)54-42-19-10-6-15-36(42)37-16-7-11-20-43(37)54/h4-28H,1-3H3 |
| InChIKey | ZXAQIRMLWCMWIM-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 63.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | 1350 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|