C17H13NO3 — CID 15460359
8-hydroxy-1,2,3,4-tetrahydrobenzo[b]phenanthridine-7,12-dione (PubChem CID 15460359) has the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. Its IUPAC name is 8-hydroxy-1,2,3,4-tetrahydrobenzo[b]phenanthridine-7,12-dione.
| Compound Name | 8-hydroxy-1,2,3,4-tetrahydrobenzo[b]phenanthridine-7,12-dione |
|---|---|
| PubChem CID | 15460359 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 8-hydroxy-1,2,3,4-tetrahydrobenzo[b]phenanthridine-7,12-dione |
| SMILES | O=C1c2ncc3c(c2C(=O)c2cccc(O)c21)CCCC3 |
| InChI | InChI=1S/C17H13NO3/c19-12-7-3-6-11-13(12)17(21)15-14(16(11)20)10-5-2-1-4-9(10)8-18-15/h3,6-8,19H,1-2,4-5H2 |
| InChIKey | INNWSRBLNMJFIF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|