About 2-methylsulfanyl-2,3-dihydrofuran-4-olate
2-methylsulfanyl-2,3-dihydrofuran-4-olate (PubChem CID 154603750) has the molecular formula C5H7O2S-
and a molecular weight of 131.18 g/mol. Its IUPAC name is 2-methylsulfanyl-2,3-dihydrofuran-4-olate.
Molecular Properties
| Compound Name | 2-methylsulfanyl-2,3-dihydrofuran-4-olate |
| PubChem CID | 154603750 |
| Molecular Formula | C5H7O2S- |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.02 |
| IUPAC Name | 2-methylsulfanyl-2,3-dihydrofuran-4-olate |
| SMILES | CSC1CC([O-])=CO1 |
| InChI | InChI=1S/C5H8O2S/c1-8-5-2-4(6)3-7-5/h3,5-6H,2H2,1H3/p-1 |
| InChIKey | NCNVHFGIPKLSSF-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfanyl-2,3-dihydrofuran-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-2,3-dihydrofuran-4-olate?
The IUPAC name of 2-methylsulfanyl-2,3-dihydrofuran-4-olate (CID 154603750) is 2-methylsulfanyl-2,3-dihydrofuran-4-olate.
What is the SMILES notation for 2-methylsulfanyl-2,3-dihydrofuran-4-olate?
The canonical SMILES for 2-methylsulfanyl-2,3-dihydrofuran-4-olate is CSC1CC([O-])=CO1.
What is the InChIKey of 2-methylsulfanyl-2,3-dihydrofuran-4-olate?
The InChIKey is NCNVHFGIPKLSSF-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O2S/c1-8-5-2-4(6)3-7-5/h3,5-6H,2H2,1H3/p-1.
What are the key properties of 2-methylsulfanyl-2,3-dihydrofuran-4-olate?
2-methylsulfanyl-2,3-dihydrofuran-4-olate has a molecular weight of 131.18 g/mol, XLogP of 0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-2,3-dihydrofuran-4-olate is sourced from PubChem (CID 154603750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).