C6H11O4S- — CID 154603752
2,3-dihydroxy-5-methylsulfanylpentanoate (PubChem CID 154603752) has the molecular formula C6H11O4S- and a molecular weight of 179.22 g/mol. Its IUPAC name is 2,3-dihydroxy-5-methylsulfanylpentanoate.
| Compound Name | 2,3-dihydroxy-5-methylsulfanylpentanoate |
|---|---|
| PubChem CID | 154603752 |
| Molecular Formula | C6H11O4S- |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 2,3-dihydroxy-5-methylsulfanylpentanoate |
| SMILES | CSCCC(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/C6H12O4S/c1-11-3-2-4(7)5(8)6(9)10/h4-5,7-8H,2-3H2,1H3,(H,9,10)/p-1 |
| InChIKey | VPLKAMXZFNCBAL-UHFFFAOYSA-M |
| XLogP | -1.79 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |