C28H24FN5O — CID 154604807
3-[2-(3-fluoro-2-pyridinyl)-2-methylpropoxy]-6-phenyl-5-quinolin-6-ylpyrazin-2-amine (PubChem CID 154604807) has the molecular formula C28H24FN5O and a molecular weight of 465.53 g/mol. Its IUPAC name is 3-[2-(3-fluoro-2-pyridinyl)-2-methylpropoxy]-6-phenyl-5-quinolin-6-ylpyrazin-2-amine.
| Compound Name | 3-[2-(3-fluoro-2-pyridinyl)-2-methylpropoxy]-6-phenyl-5-quinolin-6-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 154604807 |
| Molecular Formula | C28H24FN5O |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 3-[2-(3-fluoro-2-pyridinyl)-2-methylpropoxy]-6-phenyl-5-quinolin-6-ylpyrazin-2-amine |
| SMILES | CC(C)(COc1nc(-c2ccc3ncccc3c2)c(-c2ccccc2)nc1N)c1ncccc1F |
| InChI | InChI=1S/C28H24FN5O/c1-28(2,25-21(29)11-7-15-32-25)17-35-27-26(30)33-23(18-8-4-3-5-9-18)24(34-27)20-12-13-22-19(16-20)10-6-14-31-22/h3-16H,17H2,1-2H3,(H2,30,33) |
| InChIKey | ROJJJDZYHYTNFN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |