C22H23N3O3 — CID 154605121
1-[(2S,4R)-4-[6-(4-hydroxyphenyl)imidazo[1,5-a]pyridin-8-yl]oxy-2-methylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 154605121) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[(2S,4R)-4-[6-(4-hydroxyphenyl)imidazo[1,5-a]pyridin-8-yl]oxy-2-methylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,4R)-4-[6-(4-hydroxyphenyl)imidazo[1,5-a]pyridin-8-yl]oxy-2-methylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154605121 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[(2S,4R)-4-[6-(4-hydroxyphenyl)imidazo[1,5-a]pyridin-8-yl]oxy-2-methylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](Oc2cc(-c3ccc(O)cc3)cn3cncc23)C[C@@H]1C |
| InChI | InChI=1S/C22H23N3O3/c1-3-22(27)25-9-8-19(10-15(25)2)28-21-11-17(13-24-14-23-12-20(21)24)16-4-6-18(26)7-5-16/h3-7,11-15,19,26H,1,8-10H2,2H3/t15-,19+/m0/s1 |
| InChIKey | CFIRTRVEXIZQLT-HNAYVOBHSA-N |
| XLogP | 3.65 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|