C23H23N3O3 — CID 154605125
1-[(1S,5R)-3-[6-(4-hydroxyphenyl)imidazo[1,5-a]pyridin-8-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one (PubChem CID 154605125) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[(1S,5R)-3-[6-(4-hydroxyphenyl)imidazo[1,5-a]pyridin-8-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one.
| Compound Name | 1-[(1S,5R)-3-[6-(4-hydroxyphenyl)imidazo[1,5-a]pyridin-8-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154605125 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[(1S,5R)-3-[6-(4-hydroxyphenyl)imidazo[1,5-a]pyridin-8-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1[C@@H]2CC[C@H]1CC(Oc1cc(-c3ccc(O)cc3)cn3cncc13)C2 |
| InChI | InChI=1S/C23H23N3O3/c1-2-23(28)26-17-5-6-18(26)11-20(10-17)29-22-9-16(13-25-14-24-12-21(22)25)15-3-7-19(27)8-4-15/h2-4,7-9,12-14,17-18,20,27H,1,5-6,10-11H2/t17-,18+,20? |
| InChIKey | BMYCPAZOZCFJAW-UFRUDQCGSA-N |
| XLogP | 3.79 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|