C27H22N2O7 — CID 154607537
(2S)-4-(1,3-dioxoisoindol-2-yl)oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (PubChem CID 154607537) has the molecular formula C27H22N2O7 and a molecular weight of 486.48 g/mol. Its IUPAC name is (2S)-4-(1,3-dioxoisoindol-2-yl)oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-(1,3-dioxoisoindol-2-yl)oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 154607537 |
| Molecular Formula | C27H22N2O7 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (2S)-4-(1,3-dioxoisoindol-2-yl)oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(N[C@@H](CCON1C(=O)c2ccccc2C1=O)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H22N2O7/c30-24-20-11-5-6-12-21(20)25(31)29(24)36-14-13-23(26(32)33)28-27(34)35-15-22-18-9-3-1-7-16(18)17-8-2-4-10-19(17)22/h1-12,22-23H,13-15H2,(H,28,34)(H,32,33)/t23-/m0/s1 |
| InChIKey | VWNTUYTZLQGLFH-QHCPKHFHSA-N |
| XLogP | 3.60 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|