C18H35N5O — CID 154607581
N-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-3-[[6-(aminomethyl)-1,3-diazinan-4-yl]amino]propanamide (PubChem CID 154607581) has the molecular formula C18H35N5O and a molecular weight of 337.51 g/mol. Its IUPAC name is N-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-3-[[6-(aminomethyl)-1,3-diazinan-4-yl]amino]propanamide.
| Compound Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-3-[[6-(aminomethyl)-1,3-diazinan-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 154607581 |
| Molecular Formula | C18H35N5O |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | N-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-3-[[6-(aminomethyl)-1,3-diazinan-4-yl]amino]propanamide |
| SMILES | NCC1CC(NCCC(=O)NC2CCCC3CCCCC32)NCN1 |
| InChI | InChI=1S/C18H35N5O/c19-11-14-10-17(22-12-21-14)20-9-8-18(24)23-16-7-3-5-13-4-1-2-6-15(13)16/h13-17,20-22H,1-12,19H2,(H,23,24) |
| InChIKey | UTRJBZPPXXLAQD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |