C17H26F3NO — CID 154607679
N-[(1S)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-2-(2,4,5-trifluorocyclohexyl)acetamide (PubChem CID 154607679) has the molecular formula C17H26F3NO and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[(1S)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-2-(2,4,5-trifluorocyclohexyl)acetamide.
| Compound Name | N-[(1S)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-2-(2,4,5-trifluorocyclohexyl)acetamide |
|---|---|
| PubChem CID | 154607679 |
| Molecular Formula | C17H26F3NO |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N-[(1S)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-2-(2,4,5-trifluorocyclohexyl)acetamide |
| SMILES | O=C(CC1CC(F)C(F)CC1F)N[C@H]1CCC2CCCCC21 |
| InChI | InChI=1S/C17H26F3NO/c18-13-9-15(20)14(19)7-11(13)8-17(22)21-16-6-5-10-3-1-2-4-12(10)16/h10-16H,1-9H2,(H,21,22)/t10?,11?,12?,13?,14?,15?,16-/m0/s1 |
| InChIKey | LZPZORIYLCIGLN-VMOZUDSHSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |