About 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine
3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine (PubChem CID 154607776) has the molecular formula C10H17F2NO2
and a molecular weight of 221.25 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine.
Molecular Properties
| Compound Name | 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine |
| PubChem CID | 154607776 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine |
| SMILES | FC(F)OC1CCC(C2CCON2)CC1 |
| InChI | InChI=1S/C10H17F2NO2/c11-10(12)15-8-3-1-7(2-4-8)9-5-6-14-13-9/h7-10,13H,1-6H2 |
| InChIKey | CFOZFOKXFAXVQI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine?
The IUPAC name of 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine (CID 154607776) is 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine.
What is the SMILES notation for 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine?
The canonical SMILES for 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine is FC(F)OC1CCC(C2CCON2)CC1.
What is the InChIKey of 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine?
The InChIKey is CFOZFOKXFAXVQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO2/c11-10(12)15-8-3-1-7(2-4-8)9-5-6-14-13-9/h7-10,13H,1-6H2.
What are the key properties of 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine?
3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine has a molecular weight of 221.25 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(difluoromethoxy)cyclohexyl]-1,2-oxazolidine is sourced from PubChem (CID 154607776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).