C25H17NO2S — CID 154608035
3-[1-(4-phenylphenyl)ethenylamino]thieno[3,4-c]chromen-4-one (PubChem CID 154608035) has the molecular formula C25H17NO2S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[1-(4-phenylphenyl)ethenylamino]thieno[3,4-c]chromen-4-one.
| Compound Name | 3-[1-(4-phenylphenyl)ethenylamino]thieno[3,4-c]chromen-4-one |
|---|---|
| PubChem CID | 154608035 |
| Molecular Formula | C25H17NO2S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-[1-(4-phenylphenyl)ethenylamino]thieno[3,4-c]chromen-4-one |
| SMILES | C=C(Nc1scc2c1c(=O)oc1ccccc12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H17NO2S/c1-16(17-11-13-19(14-12-17)18-7-3-2-4-8-18)26-24-23-21(15-29-24)20-9-5-6-10-22(20)28-25(23)27/h2-15,26H,1H2 |
| InChIKey | WEPHDBQCCKIJAC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|