C22H40BFO7 — CID 154608200
2-[4-fluoro-4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 154608200) has the molecular formula C22H40BFO7 and a molecular weight of 446.37 g/mol. Its IUPAC name is 2-[4-fluoro-4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-fluoro-4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154608200 |
| Molecular Formula | C22H40BFO7 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 2-[4-fluoro-4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COCCOCCOCCOCCOCC1(F)CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C22H40BFO7/c1-20(2)21(3,4)31-23(30-20)19-6-8-22(24,9-7-19)18-29-17-16-28-15-14-27-13-12-26-11-10-25-5/h6H,7-18H2,1-5H3 |
| InChIKey | HNVPEKBGYUPVSD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|