C22H29BN4O3 — CID 154608358
3-(2-methylpyrazol-3-yl)-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 154608358) has the molecular formula C22H29BN4O3 and a molecular weight of 408.31 g/mol. Its IUPAC name is 3-(2-methylpyrazol-3-yl)-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 3-(2-methylpyrazol-3-yl)-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 154608358 |
| Molecular Formula | C22H29BN4O3 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 3-(2-methylpyrazol-3-yl)-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cn1nccc1-c1nn(C2CCCCO2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C22H29BN4O3/c1-21(2)22(3,4)30-23(29-21)15-9-10-17-16(14-15)20(18-11-12-24-26(18)5)25-27(17)19-8-6-7-13-28-19/h9-12,14,19H,6-8,13H2,1-5H3 |
| InChIKey | ARNLUBYCBPSULC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|