About [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol
[(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol (PubChem CID 154608477) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol.
Molecular Properties
| Compound Name | [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol |
| PubChem CID | 154608477 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol |
| SMILES | C[C@@]1(CO)CCCc2cccnc21 |
| InChI | InChI=1S/C11H15NO/c1-11(8-13)6-2-4-9-5-3-7-12-10(9)11/h3,5,7,13H,2,4,6,8H2,1H3/t11-/m0/s1 |
| InChIKey | OVNFTTHHQBHYMB-NSHDSACASA-N |
| XLogP | 1.67 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol?
The IUPAC name of [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol (CID 154608477) is [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol.
What is the SMILES notation for [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol?
The canonical SMILES for [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol is C[C@@]1(CO)CCCc2cccnc21.
What is the InChIKey of [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol?
The InChIKey is OVNFTTHHQBHYMB-NSHDSACASA-N. The full InChI is InChI=1S/C11H15NO/c1-11(8-13)6-2-4-9-5-3-7-12-10(9)11/h3,5,7,13H,2,4,6,8H2,1H3/t11-/m0/s1.
What are the key properties of [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol?
[(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol has a molecular weight of 177.25 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(8R)-8-methyl-6,7-dihydro-5H-quinolin-8-yl]methanol is sourced from PubChem (CID 154608477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).