About 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine
8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine (PubChem CID 154608558) has the molecular formula C22H13ClFN5
and a molecular weight of 401.83 g/mol. Its IUPAC name is 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine.
Molecular Properties
| Compound Name | 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine |
| PubChem CID | 154608558 |
| Molecular Formula | C22H13ClFN5 |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(-c2cc(Cl)c3ncccc3c2)c2nccnc12 |
| InChI | InChI=1S/C22H13ClFN5/c23-16-11-14(10-13-2-1-7-26-18(13)16)17-19(12-3-5-15(24)6-4-12)29-22(25)21-20(17)27-8-9-28-21/h1-11H,(H2,25,29) |
| InChIKey | UUQSYTXRSJMOFW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine?
The IUPAC name of 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine (CID 154608558) is 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine.
What is the SMILES notation for 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine?
The canonical SMILES for 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine is Nc1nc(-c2ccc(F)cc2)c(-c2cc(Cl)c3ncccc3c2)c2nccnc12.
What is the InChIKey of 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine?
The InChIKey is UUQSYTXRSJMOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13ClFN5/c23-16-11-14(10-13-2-1-7-26-18(13)16)17-19(12-3-5-15(24)6-4-12)29-22(25)21-20(17)27-8-9-28-21/h1-11H,(H2,25,29).
What are the key properties of 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine?
8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine has a molecular weight of 401.83 g/mol, XLogP of 5.28, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(8-chloroquinolin-6-yl)-7-(4-fluorophenyl)pyrido[3,4-b]pyrazin-5-amine is sourced from PubChem (CID 154608558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).