C17H22I3NO2 — CID 154609195
2-(2,6-dimethylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate (PubChem CID 154609195) has the molecular formula C17H22I3NO2 and a molecular weight of 653.08 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate.
| Compound Name | 2-(2,6-dimethylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 154609195 |
| Molecular Formula | C17H22I3NO2 |
| Molecular Weight | 653.08 g/mol |
| Exact Mass | 652.88 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-4-yl)propan-2-yl 2,3,5-triiodobenzoate |
| SMILES | CC1CC(C(C)(C)OC(=O)c2cc(I)cc(I)c2I)CC(C)N1 |
| InChI | InChI=1S/C17H22I3NO2/c1-9-5-11(6-10(2)21-9)17(3,4)23-16(22)13-7-12(18)8-14(19)15(13)20/h7-11,21H,5-6H2,1-4H3 |
| InChIKey | XHCVHPWEOIUTHE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.08 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|