C8H11BrO2 — CID 154609477
2-bromo-2-cyclohex-2-en-1-ylacetic acid (PubChem CID 154609477) has the molecular formula C8H11BrO2 and a molecular weight of 219.08 g/mol. Its IUPAC name is 2-bromo-2-cyclohex-2-en-1-ylacetic acid.
| Compound Name | 2-bromo-2-cyclohex-2-en-1-ylacetic acid |
|---|---|
| PubChem CID | 154609477 |
| Molecular Formula | C8H11BrO2 |
| Molecular Weight | 219.08 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 2-bromo-2-cyclohex-2-en-1-ylacetic acid |
| SMILES | O=C(O)C(Br)C1C=CCCC1 |
| InChI | InChI=1S/C8H11BrO2/c9-7(8(10)11)6-4-2-1-3-5-6/h2,4,6-7H,1,3,5H2,(H,10,11) |
| InChIKey | OAQIFZCNPBCIOA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.08 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|