C27H21FO — CID 15461019
(Z)-2-fluoro-1,3-bis(4-phenylphenyl)prop-2-en-1-ol (PubChem CID 15461019) has the molecular formula C27H21FO and a molecular weight of 380.46 g/mol. Its IUPAC name is (Z)-2-fluoro-1,3-bis(4-phenylphenyl)prop-2-en-1-ol.
| Compound Name | (Z)-2-fluoro-1,3-bis(4-phenylphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 15461019 |
| Molecular Formula | C27H21FO |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (Z)-2-fluoro-1,3-bis(4-phenylphenyl)prop-2-en-1-ol |
| SMILES | OC(/C(F)=C/c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21FO/c28-26(19-20-11-13-23(14-12-20)21-7-3-1-4-8-21)27(29)25-17-15-24(16-18-25)22-9-5-2-6-10-22/h1-19,27,29H/b26-19- |
| InChIKey | UBULAEIPBZGAHD-XHPQRKPJSA-N |
| XLogP | 7.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |