C38H34N4O — CID 154610273
5-tert-butyl-11-(5-tert-butylimidazo[1,2-f]phenanthridin-11-yl)oxyimidazo[1,2-f]phenanthridine (PubChem CID 154610273) has the molecular formula C38H34N4O and a molecular weight of 562.72 g/mol. Its IUPAC name is 5-tert-butyl-11-(5-tert-butylimidazo[1,2-f]phenanthridin-11-yl)oxyimidazo[1,2-f]phenanthridine.
| Compound Name | 5-tert-butyl-11-(5-tert-butylimidazo[1,2-f]phenanthridin-11-yl)oxyimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 154610273 |
| Molecular Formula | C38H34N4O |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | 5-tert-butyl-11-(5-tert-butylimidazo[1,2-f]phenanthridin-11-yl)oxyimidazo[1,2-f]phenanthridine |
| SMILES | CC(C)(C)c1cccc2c3ccc(Oc4ccc5c(c4)c4nccn4c4c(C(C)(C)C)cccc54)cc3c3nccn3c12 |
| InChI | InChI=1S/C38H34N4O/c1-37(2,3)31-11-7-9-27-25-15-13-23(21-29(25)35-39-17-19-41(35)33(27)31)43-24-14-16-26-28-10-8-12-32(38(4,5)6)34(28)42-20-18-40-36(42)30(26)22-24/h7-22H,1-6H3 |
| InChIKey | VKHQDZUDWPRXGP-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|