C35H20N5O+ — CID 154611382
CID 154611382 (PubChem CID 154611382) has the molecular formula C35H20N5O+ and a molecular weight of 526.58 g/mol.
| Compound Name | CID 154611382 |
|---|---|
| PubChem CID | 154611382 |
| Molecular Formula | C35H20N5O+ |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | — |
| SMILES | [C+]1=Cc2c(c3ccc(Oc4ccc5c6ccc(-c7ccccc7)cc6n6ccnc6c5c4)cc3c3nccn23)N=C1 |
| InChI | InChI=1S/C35H20N5O/c1-2-5-22(6-3-1)23-8-11-27-26-12-9-24(20-29(26)34-37-16-18-40(34)32(27)19-23)41-25-10-13-28-30(21-25)35-38-15-17-39(35)31-7-4-14-36-33(28)31/h1-3,5-21H/q+1 |
| InChIKey | IIQNCWVZIOVGII-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 56.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|