C11H8N2Se — CID 15461162
7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaene-8-selone (PubChem CID 15461162) has the molecular formula C11H8N2Se and a molecular weight of 247.16 g/mol. Its IUPAC name is 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaene-8-selone.
| Compound Name | 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaene-8-selone |
|---|---|
| PubChem CID | 15461162 |
| Molecular Formula | C11H8N2Se |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaene-8-selone |
| SMILES | [Se]=c1n2ccccc2c2ccccn12 |
| InChI | InChI=1S/C11H8N2Se/c14-11-12-7-3-1-5-9(12)10-6-2-4-8-13(10)11/h1-8H |
| InChIKey | FGKXVHHXJZLGJW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 8.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|