About 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one
7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one (PubChem CID 15461166) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one.
Analyze 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one?
The IUPAC name of 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one (CID 15461166) is 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one.
What is the SMILES notation for 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one?
The canonical SMILES for 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one is O=c1n2ccccc2c2ccccn12.
What is the InChIKey of 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one?
The InChIKey is ZVIKNFXUMZGNDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c14-11-12-7-3-1-5-9(12)10-6-2-4-8-13(10)11/h1-8H.
What are the key properties of 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one?
7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one has a molecular weight of 184.20 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-diazatricyclo[7.4.0.02,7]trideca-1,3,5,10,12-pentaen-8-one is sourced from PubChem (CID 15461166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).