About tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane
tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane (PubChem CID 154612080) has the molecular formula C21H25F5O3SSi
and a molecular weight of 480.57 g/mol. Its IUPAC name is tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane |
| PubChem CID | 154612080 |
| Molecular Formula | C21H25F5O3SSi |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC(F)(F)CCS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25F5O3SSi/c1-19(2,3)31(17-10-6-4-7-11-17,18-12-8-5-9-13-18)29-16-20(22,23)14-15-30(27,28)21(24,25)26/h4-13H,14-16H2,1-3H3 |
| InChIKey | WQKBPZVRGXUCSB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane?
The IUPAC name of tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane (CID 154612080) is tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane.
What is the SMILES notation for tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane?
The canonical SMILES for tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane is CC(C)(C)[Si](OCC(F)(F)CCS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane?
The InChIKey is WQKBPZVRGXUCSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F5O3SSi/c1-19(2,3)31(17-10-6-4-7-11-17,18-12-8-5-9-13-18)29-16-20(22,23)14-15-30(27,28)21(24,25)26/h4-13H,14-16H2,1-3H3.
What are the key properties of tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane?
tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane has a molecular weight of 480.57 g/mol, XLogP of 4.52, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[2,2-difluoro-4-(trifluoromethylsulfonyl)butoxy]-diphenylsilane is sourced from PubChem (CID 154612080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).