C18H16NNaO4 — CID 154612546
sodium 17,17-dimethyl-5-oxo-6-oxa-10-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,11,13,15-pentaene-4-carboxylate (PubChem CID 154612546) has the molecular formula C18H16NNaO4 and a molecular weight of 333.32 g/mol. Its IUPAC name is sodium 17,17-dimethyl-5-oxo-6-oxa-10-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,11,13,15-pentaene-4-carboxylate.
| Compound Name | sodium 17,17-dimethyl-5-oxo-6-oxa-10-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,11,13,15-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 154612546 |
| Molecular Formula | C18H16NNaO4 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | sodium 17,17-dimethyl-5-oxo-6-oxa-10-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,11,13,15-pentaene-4-carboxylate |
| SMILES | CC1(C)C2=C3C=C(C(=O)[O-])C(=O)OC3CCN2c2ccccc21.[Na+] |
| InChI | InChI=1S/C18H17NO4.Na/c1-18(2)12-5-3-4-6-13(12)19-8-7-14-10(15(18)19)9-11(16(20)21)17(22)23-14;/h3-6,9,14H,7-8H2,1-2H3,(H,20,21);/q;+1/p-1 |
| InChIKey | YHYZGAADLVNPSK-UHFFFAOYSA-M |
| XLogP | -1.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|