About CID 154612696
CID 154612696 (PubChem CID 154612696) has the molecular formula C24H35Si3
and a molecular weight of 407.80 g/mol.
Molecular Properties
| Compound Name | CID 154612696 |
| PubChem CID | 154612696 |
| Molecular Formula | C24H35Si3 |
| Molecular Weight | 407.80 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)CC1([Si](c2ccccc2)C2(C[Si](C)(C)C)C=CC=C2)C=CC=C1 |
| InChI | InChI=1S/C24H35Si3/c1-26(2,3)20-23(16-10-11-17-23)25(22-14-8-7-9-15-22)24(18-12-13-19-24)21-27(4,5)6/h7-19H,20-21H2,1-6H3 |
| InChIKey | MZEZWUQDSKOMHN-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.80 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 154612696 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154612696?
The IUPAC name of CID 154612696 (CID 154612696) is not available.
What is the SMILES notation for CID 154612696?
The canonical SMILES for CID 154612696 is C[Si](C)(C)CC1([Si](c2ccccc2)C2(C[Si](C)(C)C)C=CC=C2)C=CC=C1.
What is the InChIKey of CID 154612696?
The InChIKey is MZEZWUQDSKOMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35Si3/c1-26(2,3)20-23(16-10-11-17-23)25(22-14-8-7-9-15-22)24(18-12-13-19-24)21-27(4,5)6/h7-19H,20-21H2,1-6H3.
What are the key properties of CID 154612696?
CID 154612696 has a molecular weight of 407.80 g/mol, XLogP of 6.80, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154612696 is sourced from PubChem (CID 154612696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).