About 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium
1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium (PubChem CID 154612836) has the molecular formula C16H18Y-2
and a molecular weight of 299.23 g/mol. Its IUPAC name is 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium.
Molecular Properties
| Compound Name | 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium |
| PubChem CID | 154612836 |
| Molecular Formula | C16H18Y-2 |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium |
| SMILES | Cc1[c-]cccc1C.Cc1c[c-]ccc1C.[Y] |
| InChI | InChI=1S/2C8H9.Y/c2*1-7-5-3-4-6-8(7)2;/h3,5-6H,1-2H3;3-5H,1-2H3;/q2*-1; |
| InChIKey | UEADHWOLSKYKBS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium?
The IUPAC name of 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium (CID 154612836) is 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium.
What is the SMILES notation for 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium?
The canonical SMILES for 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium is Cc1[c-]cccc1C.Cc1c[c-]ccc1C.[Y].
What is the InChIKey of 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium?
The InChIKey is UEADHWOLSKYKBS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H9.Y/c2*1-7-5-3-4-6-8(7)2;/h3,5-6H,1-2H3;3-5H,1-2H3;/q2*-1;.
What are the key properties of 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium?
1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium has a molecular weight of 299.23 g/mol, XLogP of 4.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium is sourced from PubChem (CID 154612836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).