C16H18Y-2 — CID 154612836
1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium (PubChem CID 154612836) has the molecular formula C16H18Y-2 and a molecular weight of 299.23 g/mol. Its IUPAC name is 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium.
| Compound Name | 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium |
|---|---|
| PubChem CID | 154612836 |
| Molecular Formula | C16H18Y-2 |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1,2-dimethylbenzene-5-ide;1,2-dimethylbenzene-6-ide;yttrium |
| SMILES | Cc1[c-]cccc1C.Cc1c[c-]ccc1C.[Y] |
| InChI | InChI=1S/2C8H9.Y/c2*1-7-5-3-4-6-8(7)2;/h3,5-6H,1-2H3;3-5H,1-2H3;/q2*-1; |
| InChIKey | UEADHWOLSKYKBS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|