C35H20F8N2O — CID 154613165
10-[2,3,4,6-tetramethyl-5-(1,2,3,4,5,6,7,8-octafluoroacridin-9-yl)phenyl]phenoxazine (PubChem CID 154613165) has the molecular formula C35H20F8N2O and a molecular weight of 636.54 g/mol. Its IUPAC name is 10-[2,3,4,6-tetramethyl-5-(1,2,3,4,5,6,7,8-octafluoroacridin-9-yl)phenyl]phenoxazine.
| Compound Name | 10-[2,3,4,6-tetramethyl-5-(1,2,3,4,5,6,7,8-octafluoroacridin-9-yl)phenyl]phenoxazine |
|---|---|
| PubChem CID | 154613165 |
| Molecular Formula | C35H20F8N2O |
| Molecular Weight | 636.54 g/mol |
| Exact Mass | 636.14 |
| IUPAC Name | 10-[2,3,4,6-tetramethyl-5-(1,2,3,4,5,6,7,8-octafluoroacridin-9-yl)phenyl]phenoxazine |
| SMILES | Cc1c(C)c(-c2c3c(F)c(F)c(F)c(F)c3nc3c(F)c(F)c(F)c(F)c23)c(C)c(N2c3ccccc3Oc3ccccc32)c1C |
| InChI | InChI=1S/C35H20F8N2O/c1-13-14(2)21(16(4)35(15(13)3)45-17-9-5-7-11-19(17)46-20-12-8-6-10-18(20)45)22-23-25(36)27(38)29(40)31(42)33(23)44-34-24(22)26(37)28(39)30(41)32(34)43/h5-12H,1-4H3 |
| InChIKey | YAGQBCXIXQJPST-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.54 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|