About 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one
2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one (PubChem CID 154613378) has the molecular formula C17H18F2N4O3
and a molecular weight of 364.35 g/mol. Its IUPAC name is 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one |
| PubChem CID | 154613378 |
| Molecular Formula | C17H18F2N4O3 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one |
| SMILES | [H]/N=C(\CN1CCOCC1)c1c(N)[nH]c(-c2c(F)cccc2F)c(O)c1=O |
| InChI | InChI=1S/C17H18F2N4O3/c18-9-2-1-3-10(19)12(9)14-16(25)15(24)13(17(21)22-14)11(20)8-23-4-6-26-7-5-23/h1-3,20,25H,4-8H2,(H3,21,22,24)/b20-11+ |
| InChIKey | DKGXXMSHDBSFFJ-RGVLZGJSSA-N |
| XLogP | 1.31 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one?
The IUPAC name of 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one (CID 154613378) is 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one.
What is the SMILES notation for 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one?
The canonical SMILES for 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one is [H]/N=C(\CN1CCOCC1)c1c(N)[nH]c(-c2c(F)cccc2F)c(O)c1=O.
What is the InChIKey of 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one?
The InChIKey is DKGXXMSHDBSFFJ-RGVLZGJSSA-N. The full InChI is InChI=1S/C17H18F2N4O3/c18-9-2-1-3-10(19)12(9)14-16(25)15(24)13(17(21)22-14)11(20)8-23-4-6-26-7-5-23/h1-3,20,25H,4-8H2,(H3,21,22,24)/b20-11+.
What are the key properties of 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one?
2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one has a molecular weight of 364.35 g/mol, XLogP of 1.31, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(2,6-difluorophenyl)-5-hydroxy-3-(2-morpholin-4-ylethanimidoyl)-1H-pyridin-4-one is sourced from PubChem (CID 154613378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).