About 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine
2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine (PubChem CID 154613427) has the molecular formula C16H31N3
and a molecular weight of 265.44 g/mol. Its IUPAC name is 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine |
| PubChem CID | 154613427 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine |
| SMILES | Cc1nn(CCN(C)C)c(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C16H31N3/c1-12-13(15(2,3)4)14(16(5,6)7)19(17-12)11-10-18(8)9/h10-11H2,1-9H3 |
| InChIKey | YUOIPOXZAVMFMB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine (CID 154613427) is 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine is Cc1nn(CCN(C)C)c(C(C)(C)C)c1C(C)(C)C.
What is the InChIKey of 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine?
The InChIKey is YUOIPOXZAVMFMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3/c1-12-13(15(2,3)4)14(16(5,6)7)19(17-12)11-10-18(8)9/h10-11H2,1-9H3.
What are the key properties of 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine?
2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine has a molecular weight of 265.44 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-ditert-butyl-3-methylpyrazol-1-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 154613427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).