C22H31FN2O — CID 154613511
4,5-ditert-butyl-1-(4-fluorophenyl)-3-(oxan-4-yl)pyrazole (PubChem CID 154613511) has the molecular formula C22H31FN2O and a molecular weight of 358.50 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-(4-fluorophenyl)-3-(oxan-4-yl)pyrazole.
| Compound Name | 4,5-ditert-butyl-1-(4-fluorophenyl)-3-(oxan-4-yl)pyrazole |
|---|---|
| PubChem CID | 154613511 |
| Molecular Formula | C22H31FN2O |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 4,5-ditert-butyl-1-(4-fluorophenyl)-3-(oxan-4-yl)pyrazole |
| SMILES | CC(C)(C)c1c(C2CCOCC2)nn(-c2ccc(F)cc2)c1C(C)(C)C |
| InChI | InChI=1S/C22H31FN2O/c1-21(2,3)18-19(15-11-13-26-14-12-15)24-25(20(18)22(4,5)6)17-9-7-16(23)8-10-17/h7-10,15H,11-14H2,1-6H3 |
| InChIKey | XTUBDKRVCANSNJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |