C67H43N5O — CID 154613908
2-[3-[3-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-4-phenyl-6-(6-phenyldibenzofuran-4-yl)-1,3,5-triazine (PubChem CID 154613908) has the molecular formula C67H43N5O and a molecular weight of 934.12 g/mol. Its IUPAC name is 2-[3-[3-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-4-phenyl-6-(6-phenyldibenzofuran-4-yl)-1,3,5-triazine.
| Compound Name | 2-[3-[3-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-4-phenyl-6-(6-phenyldibenzofuran-4-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 154613908 |
| Molecular Formula | C67H43N5O |
| Molecular Weight | 934.12 g/mol |
| Exact Mass | 933.35 |
| IUPAC Name | 2-[3-[3-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-4-phenyl-6-(6-phenyldibenzofuran-4-yl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7cccc8c7oc7c(-c9ccccc9)cccc78)n6)c5)c4)nc(-c4ccc(-c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C67H43N5O/c1-5-17-44(18-6-1)46-33-37-49(38-34-46)60-43-61(69-64(68-60)51-39-35-47(36-40-51)45-19-7-2-8-20-45)54-27-13-25-52(41-54)53-26-14-28-55(42-53)66-70-65(50-23-11-4-12-24-50)71-67(72-66)59-32-16-31-58-57-30-15-29-56(62(57)73-63(58)59)48-21-9-3-10-22-48/h1-43H |
| InChIKey | FBIPQJAZDZAXCF-UHFFFAOYSA-N |
| XLogP | 17.23 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.12 |
| LogP ≤ 5 | 17.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |