About 3,3-diaminopropan-1-ol
3,3-diaminopropan-1-ol (PubChem CID 15461452) has the molecular formula C3H10N2O
and a molecular weight of 90.13 g/mol. Its IUPAC name is 3,3-diaminopropan-1-ol.
Molecular Properties
| Compound Name | 3,3-diaminopropan-1-ol |
| PubChem CID | 15461452 |
| Molecular Formula | C3H10N2O |
| Molecular Weight | 90.13 g/mol |
| Exact Mass | 90.08 |
| IUPAC Name | 3,3-diaminopropan-1-ol |
| SMILES | NC(N)CCO |
| InChI | InChI=1S/C3H10N2O/c4-3(5)1-2-6/h3,6H,1-2,4-5H2 |
| InChIKey | VZOPQRNXEOGYNT-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.13 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diaminopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diaminopropan-1-ol?
The IUPAC name of 3,3-diaminopropan-1-ol (CID 15461452) is 3,3-diaminopropan-1-ol.
What is the SMILES notation for 3,3-diaminopropan-1-ol?
The canonical SMILES for 3,3-diaminopropan-1-ol is NC(N)CCO.
What is the InChIKey of 3,3-diaminopropan-1-ol?
The InChIKey is VZOPQRNXEOGYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N2O/c4-3(5)1-2-6/h3,6H,1-2,4-5H2.
What are the key properties of 3,3-diaminopropan-1-ol?
3,3-diaminopropan-1-ol has a molecular weight of 90.13 g/mol, XLogP of -1.39, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diaminopropan-1-ol is sourced from PubChem (CID 15461452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).