C16H30N2O2 — CID 154614523
(2S)-2-amino-N-[(E,3S)-2,5-dimethyl-6-oxohept-4-en-3-yl]-N,3,3-trimethylbutanamide (PubChem CID 154614523) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (2S)-2-amino-N-[(E,3S)-2,5-dimethyl-6-oxohept-4-en-3-yl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[(E,3S)-2,5-dimethyl-6-oxohept-4-en-3-yl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 154614523 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | (2S)-2-amino-N-[(E,3S)-2,5-dimethyl-6-oxohept-4-en-3-yl]-N,3,3-trimethylbutanamide |
| SMILES | CC(=O)/C(C)=C/[C@H](C(C)C)N(C)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C16H30N2O2/c1-10(2)13(9-11(3)12(4)19)18(8)15(20)14(17)16(5,6)7/h9-10,13-14H,17H2,1-8H3/b11-9+/t13-,14-/m1/s1 |
| InChIKey | DWEGFAFQNZAGLB-LLVNNSLESA-N |
| XLogP | 2.38 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|