C30H40ClN3O5S3 — CID 154614909
O-methyl (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enethioate (PubChem CID 154614909) has the molecular formula C30H40ClN3O5S3 and a molecular weight of 654.32 g/mol. Its IUPAC name is O-methyl (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enethioate.
| Compound Name | O-methyl (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enethioate |
|---|---|
| PubChem CID | 154614909 |
| Molecular Formula | C30H40ClN3O5S3 |
| Molecular Weight | 654.32 g/mol |
| Exact Mass | 653.18 |
| IUPAC Name | O-methyl (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enethioate |
| SMILES | COC(=S)/C(C#N)=C/c1cc2c(s1)-c1sc(N(C)CCOC(=O)NCCOCCOCCCCCCCl)cc1C2(C)C |
| InChI | InChI=1S/C30H40ClN3O5S3/c1-30(2)23-18-22(17-21(20-32)28(40)36-4)41-26(23)27-24(30)19-25(42-27)34(3)11-14-39-29(35)33-10-13-38-16-15-37-12-8-6-5-7-9-31/h17-19H,5-16H2,1-4H3,(H,33,35)/b21-17+ |
| InChIKey | ZDNPKBYKOFDLHO-HEHNFIMWSA-N |
| XLogP | 6.99 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.32 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|