C27H36ClN3O3S2 — CID 154614990
(E)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-cyano-3-[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enamide (PubChem CID 154614990) has the molecular formula C27H36ClN3O3S2 and a molecular weight of 550.19 g/mol. Its IUPAC name is (E)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-cyano-3-[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-cyano-3-[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 154614990 |
| Molecular Formula | C27H36ClN3O3S2 |
| Molecular Weight | 550.19 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | (E)-N-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-2-cyano-3-[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enamide |
| SMILES | CN(C)c1cc2c(s1)-c1sc(/C=C(\C#N)C(=O)NCCOCCOCCCCCCCl)cc1C2(C)C |
| InChI | InChI=1S/C27H36ClN3O3S2/c1-27(2)21-16-20(35-24(21)25-22(27)17-23(36-25)31(3)4)15-19(18-29)26(32)30-10-12-34-14-13-33-11-8-6-5-7-9-28/h15-17H,5-14H2,1-4H3,(H,30,32)/b19-15+ |
| InChIKey | MBOCNSWEFQYSRM-XDJHFCHBSA-N |
| XLogP | 6.04 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.19 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|