C29H38ClN3O6S2 — CID 154615004
(E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enoic acid (PubChem CID 154615004) has the molecular formula C29H38ClN3O6S2 and a molecular weight of 624.23 g/mol. Its IUPAC name is (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 154615004 |
| Molecular Formula | C29H38ClN3O6S2 |
| Molecular Weight | 624.23 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enoic acid |
| SMILES | CN(CCOC(=O)NCCOCCOCCCCCCCl)c1cc2c(s1)-c1sc(/C=C(\C#N)C(=O)O)cc1C2(C)C |
| InChI | InChI=1S/C29H38ClN3O6S2/c1-29(2)22-17-21(16-20(19-31)27(34)35)40-25(22)26-23(29)18-24(41-26)33(3)10-13-39-28(36)32-9-12-38-15-14-37-11-7-5-4-6-8-30/h16-18H,4-15H2,1-3H3,(H,32,36)(H,34,35)/b20-16+ |
| InChIKey | FBIAWBAKZTXOAV-CAPFRKAQSA-N |
| XLogP | 6.10 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.23 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|