C27H35ClN2O4S3 — CID 154615009
(5Z)-3-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-5-[[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154615009) has the molecular formula C27H35ClN2O4S3 and a molecular weight of 583.24 g/mol. Its IUPAC name is (5Z)-3-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-5-[[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-5-[[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154615009 |
| Molecular Formula | C27H35ClN2O4S3 |
| Molecular Weight | 583.24 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | (5Z)-3-[2-[2-(6-chlorohexoxy)ethoxy]ethyl]-5-[[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)c1cc2c(s1)-c1sc(/C=C3\SC(=O)N(CCOCCOCCCCCCCl)C3=O)cc1C2(C)C |
| InChI | InChI=1S/C27H35ClN2O4S3/c1-27(2)19-15-18(35-23(19)24-20(27)17-22(37-24)29(3)4)16-21-25(31)30(26(32)36-21)10-12-34-14-13-33-11-8-6-5-7-9-28/h15-17H,5-14H2,1-4H3/b21-16- |
| InChIKey | FJLJKQKQQRCQCA-PGMHBOJBSA-N |
| XLogP | 7.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.24 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|