C30H16F14O4 — CID 15461504
4,4,5,5,6,6,6-heptafluoro-1-[4-[4-(4,4,5,5,6,6,6-heptafluoro-3-oxohexanoyl)-2-phenylphenyl]phenyl]hexane-1,3-dione (PubChem CID 15461504) has the molecular formula C30H16F14O4 and a molecular weight of 706.43 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-1-[4-[4-(4,4,5,5,6,6,6-heptafluoro-3-oxohexanoyl)-2-phenylphenyl]phenyl]hexane-1,3-dione.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-1-[4-[4-(4,4,5,5,6,6,6-heptafluoro-3-oxohexanoyl)-2-phenylphenyl]phenyl]hexane-1,3-dione |
|---|---|
| PubChem CID | 15461504 |
| Molecular Formula | C30H16F14O4 |
| Molecular Weight | 706.43 g/mol |
| Exact Mass | 706.08 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-1-[4-[4-(4,4,5,5,6,6,6-heptafluoro-3-oxohexanoyl)-2-phenylphenyl]phenyl]hexane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(-c2ccc(C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H16F14O4/c31-25(32,27(35,36)29(39,40)41)23(47)13-21(45)17-8-6-16(7-9-17)19-11-10-18(12-20(19)15-4-2-1-3-5-15)22(46)14-24(48)26(33,34)28(37,38)30(42,43)44/h1-12H,13-14H2 |
| InChIKey | XGBMWJJIAUWRML-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.43 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|