About tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate
tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate (PubChem CID 15461517) has the molecular formula C21H40N2O2SSn
and a molecular weight of 503.34 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate |
| PubChem CID | 15461517 |
| Molecular Formula | C21H40N2O2SSn |
| Molecular Weight | 503.34 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(N(C)C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C9H13N2O2S.3C4H9.Sn/c1-9(2,3)13-8(12)11(4)7-10-5-6-14-7;3*1-3-4-2;/h5H,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | PMRYNCAZZRQRLT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.34 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate?
The IUPAC name of tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate (CID 15461517) is tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate is CCCC[Sn](CCCC)(CCCC)c1cnc(N(C)C(=O)OC(C)(C)C)s1.
What is the InChIKey of tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate?
The InChIKey is PMRYNCAZZRQRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N2O2S.3C4H9.Sn/c1-9(2,3)13-8(12)11(4)7-10-5-6-14-7;3*1-3-4-2;/h5H,1-4H3;3*1,3-4H2,2H3;.
What are the key properties of tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate?
tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate has a molecular weight of 503.34 g/mol, XLogP of 6.57, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-methyl-N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 15461517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).