About [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate
[(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 154616464) has the molecular formula C17H24N4O5
and a molecular weight of 364.40 g/mol. Its IUPAC name is [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate.
Molecular Properties
| Compound Name | [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| PubChem CID | 154616464 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | CC(C)(C)n1nc([C@H]2CC[C@@H](OC(=O)ON3C(=O)CCC3=O)C2)cc1N |
| InChI | InChI=1S/C17H24N4O5/c1-17(2,3)21-13(18)9-12(19-21)10-4-5-11(8-10)25-16(24)26-20-14(22)6-7-15(20)23/h9-11H,4-8,18H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | KYPQNSQMVZTQRO-WDEREUQCSA-N |
| XLogP | 2.07 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate?
The IUPAC name of [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate (CID 154616464) is [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate.
What is the SMILES notation for [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate?
The canonical SMILES for [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate is CC(C)(C)n1nc([C@H]2CC[C@@H](OC(=O)ON3C(=O)CCC3=O)C2)cc1N.
What is the InChIKey of [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate?
The InChIKey is KYPQNSQMVZTQRO-WDEREUQCSA-N. The full InChI is InChI=1S/C17H24N4O5/c1-17(2,3)21-13(18)9-12(19-21)10-4-5-11(8-10)25-16(24)26-20-14(22)6-7-15(20)23/h9-11H,4-8,18H2,1-3H3/t10-,11+/m0/s1.
What are the key properties of [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate?
[(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate has a molecular weight of 364.40 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] (2,5-dioxopyrrolidin-1-yl) carbonate is sourced from PubChem (CID 154616464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).